C15H29F3N4O — CID 109377147
N-(5-methoxypentyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377147) has the molecular formula C15H29F3N4O and a molecular weight of 338.42 g/mol. Its IUPAC name is N-(5-methoxypentyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-(5-methoxypentyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377147 |
| Molecular Formula | C15H29F3N4O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | N-(5-methoxypentyl)-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCCOC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H29F3N4O/c1-13(15(16,17)18)21-8-10-22(11-9-21)14(19-2)20-7-5-4-6-12-23-3/h13H,4-12H2,1-3H3,(H,19,20) |
| InChIKey | IXPLTLVHLLHHMI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|