C19H36F3N5 — CID 109377217
N-ethyl-N'-[2-(1-ethylpiperidin-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377217) has the molecular formula C19H36F3N5 and a molecular weight of 391.53 g/mol. Its IUPAC name is N-ethyl-N'-[2-(1-ethylpiperidin-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(1-ethylpiperidin-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377217 |
| Molecular Formula | C19H36F3N5 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | N-ethyl-N'-[2-(1-ethylpiperidin-4-yl)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC1CCN(CC)CC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H36F3N5/c1-4-23-18(24-9-6-17-7-10-25(5-2)11-8-17)27-14-12-26(13-15-27)16(3)19(20,21)22/h16-17H,4-15H2,1-3H3,(H,23,24) |
| InChIKey | IQYUNXUXHUESFK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|