C17H33F3IN5O — CID 109377240
N-butan-2-yl-3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propanamide;hydroiodide (PubChem CID 109377240) has the molecular formula C17H33F3IN5O and a molecular weight of 507.38 g/mol. Its IUPAC name is N-butan-2-yl-3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109377240 |
| Molecular Formula | C17H33F3IN5O |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | N-butan-2-yl-3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC(C)CC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H32F3N5O.HI/c1-5-13(3)23-15(26)7-8-22-16(21-6-2)25-11-9-24(10-12-25)14(4)17(18,19)20;/h13-14H,5-12H2,1-4H3,(H,21,22)(H,23,26);1H |
| InChIKey | VTOJMBYMYITGMX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|