C14H26F3N5O — CID 109377263
N-ethyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide (PubChem CID 109377263) has the molecular formula C14H26F3N5O and a molecular weight of 337.39 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide.
| Compound Name | N-ethyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 109377263 |
| Molecular Formula | C14H26F3N5O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | N-ethyl-2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]acetamide |
| SMILES | CCNC(=O)C/N=C(\NCC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H26F3N5O/c1-4-18-12(23)10-20-13(19-5-2)22-8-6-21(7-9-22)11(3)14(15,16)17/h11H,4-10H2,1-3H3,(H,18,23)(H,19,20) |
| InChIKey | RFYQYFXAQVGFDR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|