C14H28F3N5O2S — CID 109377267
N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377267) has the molecular formula C14H28F3N5O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377267 |
| Molecular Formula | C14H28F3N5O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H28F3N5O2S/c1-4-18-13(19-6-7-20-25(23,24)5-2)22-10-8-21(9-11-22)12(3)14(15,16)17/h12,20H,4-11H2,1-3H3,(H,18,19) |
| InChIKey | FPKJOZBHCPMXTH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|