C16H30F3N5O — CID 109377361
2-[[butylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 109377361) has the molecular formula C16H30F3N5O and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[[butylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[butylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 109377361 |
| Molecular Formula | C16H30F3N5O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 2-[[butylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H30F3N5O/c1-5-6-7-20-15(21-12-14(25)22(3)4)24-10-8-23(9-11-24)13(2)16(17,18)19/h13H,5-12H2,1-4H3,(H,20,21) |
| InChIKey | HPEDOSJXVVULAM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|