About tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide
tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109377403) has the molecular formula C13H29IN4O2
and a molecular weight of 400.31 g/mol. Its IUPAC name is tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide |
| PubChem CID | 109377403 |
| Molecular Formula | C13H29IN4O2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CCN/C(=N/C)NC)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C13H28N4O2.HI/c1-7-9-17(12(18)19-13(2,3)4)10-8-16-11(14-5)15-6;/h7-10H2,1-6H3,(H2,14,15,16);1H |
| InChIKey | IIPACYKIHAFAFG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide?
The IUPAC name of tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide (CID 109377403) is tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide.
What is the SMILES notation for tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide?
The canonical SMILES for tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide is CCCN(CCN/C(=N/C)NC)C(=O)OC(C)(C)C.I.
What is the InChIKey of tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide?
The InChIKey is IIPACYKIHAFAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N4O2.HI/c1-7-9-17(12(18)19-13(2,3)4)10-8-16-11(14-5)15-6;/h7-10H2,1-6H3,(H2,14,15,16);1H.
What are the key properties of tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide?
tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide has a molecular weight of 400.31 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide is sourced from PubChem (CID 109377403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).