C14H25F6IN4 — CID 109377450
N'-methyl-N-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377450) has the molecular formula C14H25F6IN4 and a molecular weight of 490.27 g/mol. Its IUPAC name is N'-methyl-N-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377450 |
| Molecular Formula | C14H25F6IN4 |
| Molecular Weight | 490.27 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N'-methyl-N-(5,5,5-trifluoropentyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCC(F)(F)F)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C14H24F6N4.HI/c1-11(14(18,19)20)23-7-9-24(10-8-23)12(21-2)22-6-4-3-5-13(15,16)17;/h11H,3-10H2,1-2H3,(H,21,22);1H |
| InChIKey | XKHUKNQHMORFGE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|