C17H26F3IN4O2 — CID 109377476
N-[(2-hydroxy-5-methoxyphenyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377476) has the molecular formula C17H26F3IN4O2 and a molecular weight of 502.32 g/mol. Its IUPAC name is N-[(2-hydroxy-5-methoxyphenyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(2-hydroxy-5-methoxyphenyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377476 |
| Molecular Formula | C17H26F3IN4O2 |
| Molecular Weight | 502.32 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-[(2-hydroxy-5-methoxyphenyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cc(OC)ccc1O)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H25F3N4O2.HI/c1-12(17(18,19)20)23-6-8-24(9-7-23)16(21-2)22-11-13-10-14(26-3)4-5-15(13)25;/h4-5,10,12,25H,6-9,11H2,1-3H3,(H,21,22);1H |
| InChIKey | NMMAXTODZPKKPF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|