C20H32F3N5O — CID 109377573
N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377573) has the molecular formula C20H32F3N5O and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377573 |
| Molecular Formula | C20H32F3N5O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccco1)N1CCCCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H32F3N5O/c1-16(20(21,22)23)26-10-12-28(13-11-26)19(24-2)25-15-17(18-7-6-14-29-18)27-8-4-3-5-9-27/h6-7,14,16-17H,3-5,8-13,15H2,1-2H3,(H,24,25) |
| InChIKey | UTAIKFFFFBAFFT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|