C15H31F3IN5O — CID 109377600
N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377600) has the molecular formula C15H31F3IN5O and a molecular weight of 481.35 g/mol. Its IUPAC name is N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377600 |
| Molecular Formula | C15H31F3IN5O |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C)CCOC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H30F3N5O.HI/c1-13(15(16,17)18)22-7-9-23(10-8-22)14(19-2)20-5-6-21(3)11-12-24-4;/h13H,5-12H2,1-4H3,(H,19,20);1H |
| InChIKey | OEEPWQZGZPJIKN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|