C18H33F3IN5O — CID 109377610
N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide (PubChem CID 109377610) has the molecular formula C18H33F3IN5O and a molecular weight of 519.40 g/mol. Its IUPAC name is N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109377610 |
| Molecular Formula | C18H33F3IN5O |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | N-[2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide |
| SMILES | CC(C(F)(F)F)N1CCN(CC1)C(=NC)NCCNC(=O)C2CCCCC2.I |
| InChI | InChI=1S/C18H32F3N5O.HI/c1-14(18(19,20)21)25-10-12-26(13-11-25)17(22-2)24-9-8-23-16(27)15-6-4-3-5-7-15;/h14-15H,3-13H2,1-2H3,(H,22,24)(H,23,27);1H |
| InChIKey | ZACONEFIHDUIRB-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 60.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | 498 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|