C17H33F3IN5 — CID 109377624
N-[(1-ethylpiperidin-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377624) has the molecular formula C17H33F3IN5 and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[(1-ethylpiperidin-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(1-ethylpiperidin-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377624 |
| Molecular Formula | C17H33F3IN5 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[(1-ethylpiperidin-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN1CCCC(CN/C(=N\C)N2CCN(C(C)C(F)(F)F)CC2)C1.I |
| InChI | InChI=1S/C17H32F3N5.HI/c1-4-23-7-5-6-15(13-23)12-22-16(21-3)25-10-8-24(9-11-25)14(2)17(18,19)20;/h14-15H,4-13H2,1-3H3,(H,21,22);1H |
| InChIKey | ABGQPKOIAUUNGU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|