C15H27F3N4 — CID 109377689
N-ethyl-N'-[(E)-pent-3-enyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377689) has the molecular formula C15H27F3N4 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-ethyl-N'-[(E)-pent-3-enyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(E)-pent-3-enyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377689 |
| Molecular Formula | C15H27F3N4 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | N-ethyl-N'-[(E)-pent-3-enyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/C=C/CC/N=C(\NCC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H27F3N4/c1-4-6-7-8-20-14(19-5-2)22-11-9-21(10-12-22)13(3)15(16,17)18/h4,6,13H,5,7-12H2,1-3H3,(H,19,20)/b6-4+ |
| InChIKey | MAUVYJVVVACXDG-GQCTYLIASA-N |
| XLogP | 2.49 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|