C13H25N3O — CID 109377909
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(3-methylbutyl)guanidine (PubChem CID 109377909) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(3-methylbutyl)guanidine.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 109377909 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-(3-methylbutyl)guanidine |
| SMILES | CC(C)CC/N=C(\N)NCCC1=CCOCC1 |
| InChI | InChI=1S/C13H25N3O/c1-11(2)3-7-15-13(14)16-8-4-12-5-9-17-10-6-12/h5,11H,3-4,6-10H2,1-2H3,(H3,14,15,16) |
| InChIKey | GPWUHRQCLWGINA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|