C16H27F3N4 — CID 109378125
N-[(1-cyclopropylcyclopropyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378125) has the molecular formula C16H27F3N4 and a molecular weight of 332.41 g/mol. Its IUPAC name is N-[(1-cyclopropylcyclopropyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[(1-cyclopropylcyclopropyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378125 |
| Molecular Formula | C16H27F3N4 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[(1-cyclopropylcyclopropyl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(C2CC2)CC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H27F3N4/c1-12(16(17,18)19)22-7-9-23(10-8-22)14(20-2)21-11-15(5-6-15)13-3-4-13/h12-13H,3-11H2,1-2H3,(H,20,21) |
| InChIKey | FIJHZFSLOIJQJE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|