About dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate
dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate (PubChem CID 10937820) has the molecular formula C23H26O5
and a molecular weight of 382.46 g/mol. Its IUPAC name is dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate |
| PubChem CID | 10937820 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=CC=C(C)C2=C(C)C=C(C(C)(C)C)C=C(C=O)C2=C1C(=O)OC |
| InChI | InChI=1S/C23H26O5/c1-13-8-9-17(21(25)27-6)20(22(26)28-7)19-15(12-24)11-16(23(3,4)5)10-14(2)18(13)19/h8-12H,1-7H3 |
| InChIKey | MXVRKBDRXWLGGZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate?
The IUPAC name of dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate (CID 10937820) is dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate is COC(=O)C1=CC=C(C)C2=C(C)C=C(C(C)(C)C)C=C(C=O)C2=C1C(=O)OC.
What is the InChIKey of dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate?
The InChIKey is MXVRKBDRXWLGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26O5/c1-13-8-9-17(21(25)27-6)20(22(26)28-7)19-15(12-24)11-16(23(3,4)5)10-14(2)18(13)19/h8-12H,1-7H3.
What are the key properties of dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate?
dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate has a molecular weight of 382.46 g/mol, XLogP of 3.94, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 8-tert-butyl-10-formyl-5,6-dimethylheptalene-1,2-dicarboxylate is sourced from PubChem (CID 10937820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).