C15H28F3N5O — CID 109378205
3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 109378205) has the molecular formula C15H28F3N5O and a molecular weight of 351.42 g/mol. Its IUPAC name is 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 109378205 |
| Molecular Formula | C15H28F3N5O |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | C/N=C(\NCCC(=O)NC(C)C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H28F3N5O/c1-11(2)21-13(24)5-6-20-14(19-4)23-9-7-22(8-10-23)12(3)15(16,17)18/h11-12H,5-10H2,1-4H3,(H,19,20)(H,21,24) |
| InChIKey | ARJXUAPBZIOFNM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|