C21H32F3N5O — CID 109378215
N'-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378215) has the molecular formula C21H32F3N5O and a molecular weight of 427.52 g/mol. Its IUPAC name is N'-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378215 |
| Molecular Formula | C21H32F3N5O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N'-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(CN2CCOCC2)cc1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H32F3N5O/c1-17(21(22,23)24)28-7-9-29(10-8-28)20(25-2)26-15-18-3-5-19(6-4-18)16-27-11-13-30-14-12-27/h3-6,17H,7-16H2,1-2H3,(H,25,26) |
| InChIKey | RBFQVNPOXIHFBJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|