C20H38F3N5 — CID 109378315
N-ethyl-N'-[[1-(2-methylpropyl)piperidin-3-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378315) has the molecular formula C20H38F3N5 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(2-methylpropyl)piperidin-3-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[1-(2-methylpropyl)piperidin-3-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378315 |
| Molecular Formula | C20H38F3N5 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | N-ethyl-N'-[[1-(2-methylpropyl)piperidin-3-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCCN(CC(C)C)C1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H38F3N5/c1-5-24-19(25-13-18-7-6-8-26(15-18)14-16(2)3)28-11-9-27(10-12-28)17(4)20(21,22)23/h16-18H,5-15H2,1-4H3,(H,24,25) |
| InChIKey | YFKINKGXZBWULX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|