C18H32F3N5O — CID 109378327
N-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]cyclobutanecarboxamide (PubChem CID 109378327) has the molecular formula C18H32F3N5O and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 109378327 |
| Molecular Formula | C18H32F3N5O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-[3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]propyl]cyclobutanecarboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)C1CCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H32F3N5O/c1-3-22-17(24-9-5-8-23-16(27)15-6-4-7-15)26-12-10-25(11-13-26)14(2)18(19,20)21/h14-15H,3-13H2,1-2H3,(H,22,24)(H,23,27) |
| InChIKey | NXHPDIIEMCGNKT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|