C18H36F3IN4O — CID 109378330
N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109378330) has the molecular formula C18H36F3IN4O and a molecular weight of 508.41 g/mol. Its IUPAC name is N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109378330 |
| Molecular Formula | C18H36F3IN4O |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N'-(2,2-diethyl-4-hydroxybutyl)-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)(CC)CCO)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H35F3N4O.HI/c1-5-17(6-2,8-13-26)14-23-16(22-7-3)25-11-9-24(10-12-25)15(4)18(19,20)21;/h15,26H,5-14H2,1-4H3,(H,22,23);1H |
| InChIKey | BDDURORYFSULLV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|