C17H32F3N5O2S — CID 109378353
N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378353) has the molecular formula C17H32F3N5O2S and a molecular weight of 427.54 g/mol. Its IUPAC name is N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378353 |
| Molecular Formula | C17H32F3N5O2S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N'-[2-(cyclobutylmethylsulfamoyl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H32F3N5O2S/c1-3-21-16(22-7-12-28(26,27)23-13-15-5-4-6-15)25-10-8-24(9-11-25)14(2)17(18,19)20/h14-15,23H,3-13H2,1-2H3,(H,21,22) |
| InChIKey | UATIBGOMJKFSKO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|