C12H24F3N5O2S — CID 109378366
N-ethyl-N'-(2-sulfamoylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378366) has the molecular formula C12H24F3N5O2S and a molecular weight of 359.42 g/mol. Its IUPAC name is N-ethyl-N'-(2-sulfamoylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-sulfamoylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378366 |
| Molecular Formula | C12H24F3N5O2S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-ethyl-N'-(2-sulfamoylethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H24F3N5O2S/c1-3-17-11(18-4-9-23(16,21)22)20-7-5-19(6-8-20)10(2)12(13,14)15/h10H,3-9H2,1-2H3,(H,17,18)(H2,16,21,22) |
| InChIKey | QQCLGYALTLNABU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|