C19H36F3N5O — CID 109378394
N-ethyl-N'-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378394) has the molecular formula C19H36F3N5O and a molecular weight of 407.53 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378394 |
| Molecular Formula | C19H36F3N5O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | N-ethyl-N'-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CN(CC(C)C)CCO1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H36F3N5O/c1-5-23-18(24-12-17-14-25(10-11-28-17)13-15(2)3)27-8-6-26(7-9-27)16(4)19(20,21)22/h15-17H,5-14H2,1-4H3,(H,23,24) |
| InChIKey | ICQLNNAXQAFLBG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|