C15H25F3IN5S — CID 109378447
N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109378447) has the molecular formula C15H25F3IN5S and a molecular weight of 491.37 g/mol. Its IUPAC name is N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109378447 |
| Molecular Formula | C15H25F3IN5S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H24F3N5S.HI/c1-4-19-14(21-10-13-9-20-12(3)24-13)23-7-5-22(6-8-23)11(2)15(16,17)18;/h9,11H,4-8,10H2,1-3H3,(H,19,21);1H |
| InChIKey | NXBUJFSKKFLRNE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|