C17H33F3IN5O2 — CID 109378468
2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 109378468) has the molecular formula C17H33F3IN5O2 and a molecular weight of 523.38 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109378468 |
| Molecular Formula | C17H33F3IN5O2 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H32F3N5O2.HI/c1-5-27-12-6-7-21-16(22-13-15(26)23(3)4)25-10-8-24(9-11-25)14(2)17(18,19)20;/h14H,5-13H2,1-4H3,(H,21,22);1H |
| InChIKey | WOFFJSFIBIIFRQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|