C15H30F3N5O2S — CID 109378532
N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378532) has the molecular formula C15H30F3N5O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378532 |
| Molecular Formula | C15H30F3N5O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-(diethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H30F3N5O2S/c1-5-23(6-2)26(24,25)12-7-20-14(19-4)22-10-8-21(9-11-22)13(3)15(16,17)18/h13H,5-12H2,1-4H3,(H,19,20) |
| InChIKey | GAYBDCSKUHUZNN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|