C14H27F3IN5O — CID 109378633
2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propylacetamide;hydroiodide (PubChem CID 109378633) has the molecular formula C14H27F3IN5O and a molecular weight of 465.30 g/mol. Its IUPAC name is 2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109378633 |
| Molecular Formula | C14H27F3IN5O |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)CN/C(=N\C)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C14H26F3N5O.HI/c1-4-5-19-12(23)10-20-13(18-3)22-8-6-21(7-9-22)11(2)14(15,16)17;/h11H,4-10H2,1-3H3,(H,18,20)(H,19,23);1H |
| InChIKey | NNTGBEPLFFGXTE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|