C14H25F3N4O2 — CID 109378642
methyl 2-methyl-3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate (PubChem CID 109378642) has the molecular formula C14H25F3N4O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is methyl 2-methyl-3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate.
| Compound Name | methyl 2-methyl-3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 109378642 |
| Molecular Formula | C14H25F3N4O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | methyl 2-methyl-3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCC(C)C(=O)OC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H25F3N4O2/c1-10(12(22)23-4)9-19-13(18-3)21-7-5-20(6-8-21)11(2)14(15,16)17/h10-11H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | MXJLDBBFNWYTDC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|