C16H32F3N5O — CID 109378646
N-[3-[2-methoxyethyl(methyl)amino]propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378646) has the molecular formula C16H32F3N5O and a molecular weight of 367.46 g/mol. Its IUPAC name is N-[3-[2-methoxyethyl(methyl)amino]propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[3-[2-methoxyethyl(methyl)amino]propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378646 |
| Molecular Formula | C16H32F3N5O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | N-[3-[2-methoxyethyl(methyl)amino]propyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCN(C)CCOC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H32F3N5O/c1-14(16(17,18)19)23-8-10-24(11-9-23)15(20-2)21-6-5-7-22(3)12-13-25-4/h14H,5-13H2,1-4H3,(H,20,21) |
| InChIKey | OMDMLYZUFYZESO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|