C14H24F3N7 — CID 109378670
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378670) has the molecular formula C14H24F3N7 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378670 |
| Molecular Formula | C14H24F3N7 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F3N7/c1-10(14(15,16)17)23-5-7-24(8-6-23)13(18-3)19-9-12-21-20-11(2)22(12)4/h10H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | ZJSIPVUFAWNVIC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|