C16H30F3N5O2S — CID 109378914
N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378914) has the molecular formula C16H30F3N5O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378914 |
| Molecular Formula | C16H30F3N5O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)(=O)NCC1CCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H30F3N5O2S/c1-13(16(17,18)19)23-7-9-24(10-8-23)15(20-2)21-6-11-27(25,26)22-12-14-4-3-5-14/h13-14,22H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | RXIYLMBZWNTOED-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|