C15H27F6N5 — CID 109378972
N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109378972) has the molecular formula C15H27F6N5 and a molecular weight of 391.40 g/mol. Its IUPAC name is N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109378972 |
| Molecular Formula | C15H27F6N5 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H27F6N5/c1-12(15(19,20)21)25-7-9-26(10-8-25)13(22-2)23-5-4-6-24(3)11-14(16,17)18/h12H,4-11H2,1-3H3,(H,22,23) |
| InChIKey | LNOQRQQNUPVEHD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|