C13H24F3IN4O2 — CID 109379001
methyl 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate;hydroiodide (PubChem CID 109379001) has the molecular formula C13H24F3IN4O2 and a molecular weight of 452.26 g/mol. Its IUPAC name is methyl 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 109379001 |
| Molecular Formula | C13H24F3IN4O2 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | methyl 3-[[N-methyl-C-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]carbonimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C13H23F3N4O2.HI/c1-10(13(14,15)16)19-6-8-20(9-7-19)12(17-2)18-5-4-11(21)22-3;/h10H,4-9H2,1-3H3,(H,17,18);1H |
| InChIKey | IDKFOOMGYCBKNO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|