C17H30F3IN4 — CID 109379045
N'-[2-(cyclopenten-1-yl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379045) has the molecular formula C17H30F3IN4 and a molecular weight of 474.35 g/mol. Its IUPAC name is N'-[2-(cyclopenten-1-yl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(cyclopenten-1-yl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379045 |
| Molecular Formula | C17H30F3IN4 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N'-[2-(cyclopenten-1-yl)ethyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCCC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H29F3N4.HI/c1-3-21-16(22-9-8-15-6-4-5-7-15)24-12-10-23(11-13-24)14(2)17(18,19)20;/h6,14H,3-5,7-13H2,1-2H3,(H,21,22);1H |
| InChIKey | OGMULELJZZZKIG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|