C16H30F3N5O2S — CID 109379048
N-ethyl-N'-[(1-methylsulfonylpyrrolidin-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379048) has the molecular formula C16H30F3N5O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is N-ethyl-N'-[(1-methylsulfonylpyrrolidin-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(1-methylsulfonylpyrrolidin-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379048 |
| Molecular Formula | C16H30F3N5O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-ethyl-N'-[(1-methylsulfonylpyrrolidin-3-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)C1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H30F3N5O2S/c1-4-20-15(21-11-14-5-6-24(12-14)27(3,25)26)23-9-7-22(8-10-23)13(2)16(17,18)19/h13-14H,4-12H2,1-3H3,(H,20,21) |
| InChIKey | QLZMRTREOJJHQV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|