C22H35F3IN5O — CID 109379121
N-ethyl-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379121) has the molecular formula C22H35F3IN5O and a molecular weight of 569.45 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379121 |
| Molecular Formula | C22H35F3IN5O |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | N-ethyl-N'-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCOCC2)cc1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C22H34F3N5O.HI/c1-3-26-21(30-10-8-29(9-11-30)18(2)22(23,24)25)27-16-19-4-6-20(7-5-19)17-28-12-14-31-15-13-28;/h4-7,18H,3,8-17H2,1-2H3,(H,26,27);1H |
| InChIKey | LPGZNRDUOGXJDU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|