C15H29F3IN5O — CID 109379125
2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-propylacetamide;hydroiodide (PubChem CID 109379125) has the molecular formula C15H29F3IN5O and a molecular weight of 479.33 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-propylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-propylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109379125 |
| Molecular Formula | C15H29F3IN5O |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-propylacetamide;hydroiodide |
| SMILES | CCCNC(=O)C/N=C(\NCC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H28F3N5O.HI/c1-4-6-20-13(24)11-21-14(19-5-2)23-9-7-22(8-10-23)12(3)15(16,17)18;/h12H,4-11H2,1-3H3,(H,19,21)(H,20,24);1H |
| InChIKey | RWCXHMLFZGPFJK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|