C18H34F3IN4O — CID 109379369
N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379369) has the molecular formula C18H34F3IN4O and a molecular weight of 506.40 g/mol. Its IUPAC name is N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379369 |
| Molecular Formula | C18H34F3IN4O |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N'-[[1-(2-ethoxyethyl)cyclopropyl]methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(CCOCC)CC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H33F3N4O.HI/c1-4-22-16(23-14-17(6-7-17)8-13-26-5-2)25-11-9-24(10-12-25)15(3)18(19,20)21;/h15H,4-14H2,1-3H3,(H,22,23);1H |
| InChIKey | JLISNIUADFCRMD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|