C20H36F3N5O — CID 109379382
N-ethyl-N'-[(4-pyrrolidin-1-yloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379382) has the molecular formula C20H36F3N5O and a molecular weight of 419.54 g/mol. Its IUPAC name is N-ethyl-N'-[(4-pyrrolidin-1-yloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-pyrrolidin-1-yloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379382 |
| Molecular Formula | C20H36F3N5O |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | N-ethyl-N'-[(4-pyrrolidin-1-yloxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(N2CCCC2)CCOCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H36F3N5O/c1-3-24-18(27-12-10-26(11-13-27)17(2)20(21,22)23)25-16-19(6-14-29-15-7-19)28-8-4-5-9-28/h17H,3-16H2,1-2H3,(H,24,25) |
| InChIKey | VEIDTMLQBNFUNE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|