C15H27F3N4O2 — CID 109379430
methyl 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate (PubChem CID 109379430) has the molecular formula C15H27F3N4O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is methyl 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 109379430 |
| Molecular Formula | C15H27F3N4O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl 3-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-2-methylpropanoate |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H27F3N4O2/c1-5-19-14(20-10-11(2)13(23)24-4)22-8-6-21(7-9-22)12(3)15(16,17)18/h11-12H,5-10H2,1-4H3,(H,19,20) |
| InChIKey | FLAHTJJXSPOFBX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|