C17H35F3IN5O — CID 109379437
N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379437) has the molecular formula C17H35F3IN5O and a molecular weight of 509.40 g/mol. Its IUPAC name is N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379437 |
| Molecular Formula | C17H35F3IN5O |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)CCOC)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H34F3N5O.HI/c1-5-21-16(22-7-6-8-23(3)13-14-26-4)25-11-9-24(10-12-25)15(2)17(18,19)20;/h15H,5-14H2,1-4H3,(H,21,22);1H |
| InChIKey | RTSBUDXVJWDPMV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|