C11H21F3N2O2 — CID 109379521
1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 109379521) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 109379521 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(3-hydroxy-2,2,4-trimethylpentyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-7(2)8(17)10(3,4)5-15-9(18)16-6-11(12,13)14/h7-8,17H,5-6H2,1-4H3,(H2,15,16,18) |
| InChIKey | NHFZRXQJIXYNCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |