C16H27NO3S — CID 109379684
N-(3-hydroxy-2,2,4-trimethylpentyl)-2-phenylethanesulfonamide (PubChem CID 109379684) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-2-phenylethanesulfonamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 109379684 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-2-phenylethanesulfonamide |
| SMILES | CC(C)C(O)C(C)(C)CNS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C16H27NO3S/c1-13(2)15(18)16(3,4)12-17-21(19,20)11-10-14-8-6-5-7-9-14/h5-9,13,15,17-18H,10-12H2,1-4H3 |
| InChIKey | CDYFVYJOHVEZFS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |