C13H14Cl2N2OS — CID 109379738
3-[[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]methylamino]propan-1-ol (PubChem CID 109379738) has the molecular formula C13H14Cl2N2OS and a molecular weight of 317.24 g/mol. Its IUPAC name is 3-[[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]methylamino]propan-1-ol.
| Compound Name | 3-[[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 109379738 |
| Molecular Formula | C13H14Cl2N2OS |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 3-[[4-(2,5-dichlorophenyl)-1,3-thiazol-2-yl]methylamino]propan-1-ol |
| SMILES | OCCCNCc1nc(-c2cc(Cl)ccc2Cl)cs1 |
| InChI | InChI=1S/C13H14Cl2N2OS/c14-9-2-3-11(15)10(6-9)12-8-19-13(17-12)7-16-4-1-5-18/h2-3,6,8,16,18H,1,4-5,7H2 |
| InChIKey | LASDBFTUMNWITE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|