C25H40O3 — CID 10937978
(6E,10E,14E)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-5-one (PubChem CID 10937978) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (6E,10E,14E)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-5-one.
| Compound Name | (6E,10E,14E)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-5-one |
|---|---|
| PubChem CID | 10937978 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (6E,10E,14E)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-5-one |
| SMILES | CC(C)=CCC(=O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C25H40O3/c1-20(2)15-16-24(26)23(5)13-9-12-21(3)10-8-11-22(4)17-19-28-25-14-6-7-18-27-25/h10,13,15,17,25H,6-9,11-12,14,16,18-19H2,1-5H3/b21-10+,22-17+,23-13+ |
| InChIKey | KDYAWBIYGYOYGL-LAMIVTGISA-N |
| XLogP | 6.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|