C15H24BrNO2 — CID 109380074
2-bromo-6-[[(3-hydroxy-2,2,4-trimethylpentyl)amino]methyl]phenol (PubChem CID 109380074) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-bromo-6-[[(3-hydroxy-2,2,4-trimethylpentyl)amino]methyl]phenol.
| Compound Name | 2-bromo-6-[[(3-hydroxy-2,2,4-trimethylpentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 109380074 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-bromo-6-[[(3-hydroxy-2,2,4-trimethylpentyl)amino]methyl]phenol |
| SMILES | CC(C)C(O)C(C)(C)CNCc1cccc(Br)c1O |
| InChI | InChI=1S/C15H24BrNO2/c1-10(2)14(19)15(3,4)9-17-8-11-6-5-7-12(16)13(11)18/h5-7,10,14,17-19H,8-9H2,1-4H3 |
| InChIKey | DGMFEDZVZDHNOW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|