C15H18F3N3OS — CID 109380288
2-[[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methylamino]-2-(3,4,5-trifluorophenyl)ethanol (PubChem CID 109380288) has the molecular formula C15H18F3N3OS and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methylamino]-2-(3,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-[[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 109380288 |
| Molecular Formula | C15H18F3N3OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methylamino]-2-(3,4,5-trifluorophenyl)ethanol |
| SMILES | Cc1nc(N(C)C)sc1CNC(CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H18F3N3OS/c1-8-13(23-15(20-8)21(2)3)6-19-12(7-22)9-4-10(16)14(18)11(17)5-9/h4-5,12,19,22H,6-7H2,1-3H3 |
| InChIKey | QQXOAOAGUYNNGB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|