C22H24N4O3 — CID 10938033
tert-butyl (1R,4R)-5-(6-oxo-5H-benzo[h][1,5]naphthyridin-2-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 10938033) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is tert-butyl (1R,4R)-5-(6-oxo-5H-benzo[h][1,5]naphthyridin-2-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,4R)-5-(6-oxo-5H-benzo[h][1,5]naphthyridin-2-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10938033 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | tert-butyl (1R,4R)-5-(6-oxo-5H-benzo[h][1,5]naphthyridin-2-yl)-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1CN2c1ccc2[nH]c(=O)c3ccccc3c2n1 |
| InChI | InChI=1S/C22H24N4O3/c1-22(2,3)29-21(28)26-12-13-10-14(26)11-25(13)18-9-8-17-19(24-18)15-6-4-5-7-16(15)20(27)23-17/h4-9,13-14H,10-12H2,1-3H3,(H,23,27)/t13-,14-/m1/s1 |
| InChIKey | SPOXGLLCBWABKW-ZIAGYGMSSA-N |
| XLogP | 3.27 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|